The compound C6H5COCH2CH(Fc)SSCH(Fc)CH2COC6H5 is synthesized by the ox
idation of 1-phenyl-3-ferrocenyl-1-oxo-3-mercapto-propane which is obt
ained from nucleophilic addition of H2S to the 1-ferrocenyl-3-phenyl-3
-oxo-propene. Its crystal structure has been determined by X-ray cryst
allography, it crystallizes in the triclinic system, space group <P(1)
over bar> with a=11.491(5), b=11.805(5), c=12.510(5)Angstrom, alpha=10
9.00(3), beta=93.90(4), gamma=99.56(4)degrees, V=1568.7 Angstrom(3), a
nd Z=2.