Jt. Lin et al., DIPHENYLPHOSPHINE DERIVATIVES OF CO(NO)(CO)(3), FE(NO)(2)(CO)(2) AND MN(NO)(CO)(4), Journal of organometallic chemistry, 508(1-2), 1996, pp. 183-193
The complexes Co(NO)(CO)(Ph(2)PH)(2) (1), Fe(NO)(2)(Ph(2)PH)(2) (2) an
d Mn(NO)(CO)(2)(Ph(2)PH)(2) (3) are synthesized from Co(NO)(CO)(3), Fe
(NO)(2)(CO)(2) and Mn(NO)(CO)(4) respectively. Deprotonation of 1 with
two equivalents of BuLi followed by subsequent addition of methyl iod
ide, allyl bromide and propargyl bromide provides Co(NO)(CO)(Ph(2)PMe)
(2) (4), Co(NO)(CO)(Ph(2)PCH(2)CHCH(2))(2) (5) and Co(NO)(CO)(Ph(2)PCH
(2)CCH)(2) (6) respectively. X-ray crystal structure analyses for 1, 3
and 4-6 were carried out to give data as followed. 1: monoclinic; C2/
c; Z = 4; a = 17.130(5), b = 9.894(2) and c = 42.607(1) Angstrom; beta
= 93.29(2)degrees; V = 7210(2) Angstrom(3); R = 0.056; R(w) = 0.058.
3: monoclinic; C2/c; Z = 4; a = 15.231(5), b = 10.247(2) and c = 16.31
1(2) Angstrom; beta = 102.29(2)degrees; V = 2488(1) Angstrom(3); R = 0
.041; R(w) = 0.042. 4: monoclinic; C2/c; Z = 4; a = 15.556(3), b = 12.
072(1) and c = 14.809(2) Angstrom; beta 114.43(1)degrees; V = 2532.0(7
) Angstrom(3); R = 0.032; R(w) = 0.031. 5: monoclinic; P2(1)/c; Z = 4;
a = 15.427(2), b = 10.118(2) and c = 18.793(6) Angstrom; beta = 102.5
6(1)degrees; V = 2863(1) Angstrom(3); R = 0.042; R(w) = 0.046. 6: mono
clinic; P2(1)/n; Z = 4; a = 9.3393(8), b = 19.035(4) and c = 16.007(1)
Angstrom; beta = 94.912(7)degrees; V = 2845.8(6) Angstrom(3); R = 0.0
52; R(w) = 0.059.