SYNTHESIS AND CHARACTERIZATION OF SRCU2(O(2)CR)(3)(BDMAP)(3) AND BI-2(O2CCH3)(4)(BDMAP)(2)(H2O) (R=CH3, CF3 BDMAP=1,3-BIS(DIMETHYLAMINO)-2-PROPANOLATO)

New mixed metal complexes SrCu2(O(2)CR)(3)(bdmap)(3) (R = CF3 (1a), CH 3 (1b)) and a new dinuclear bismuth complex Bi-2(O2CCH3)(4)(bdmap)(2)( H2O) (2) have been synthesized. Their crystal structures have been det ermined by single-crystal X-ray diffraction analyses. Thermal decompos ition behaviors of these complexes have been examined by TGA and X-ray powder diffraction analyses. While compound 1a decomposes to SrF2 and CuO at about 380 degrees C, compound 1b decomposes to the correspondi ng oxides above 800 degrees C. Compound 2 decomposes cleanly to Bi2O3 at 330 degrees C. The magnetism of 1a was examined by the measurement of susceptibility from 5-300 K. Theoretical fitting for the susceptibi lity data revealed that 1a is an antiferromagnetically coupled system with g = 2.012(7), -2J = 34.0(8) cm(-1). Crystal data for 1a: C27H51N6 O9F9Cu2Sr/THF, monoclinic space group P2(1)/m, a = 10.708(6), b = 15.2 0(1), c = 15.404(7) Angstrom, beta = 107.94(4)degrees, V = 2386(2) Ang strom(3), Z = 2; for 1b: C27H60N6O9Cu2Sr/THF, orthorhombic space group Pbcn, a = 19.164(9), b = 26.829(8), c = 17.240(9) Angstrom, V = 8864( 5) Angstrom(3), Z = 8; for 2: C22H48O11N4Bi2, monoclinic space group P 2(1)/c, a = 17.614(9), b = 10.741(3), c = 18.910(7) Angstrom, beta = 1 09.99(3)degrees, V = 3362(2) Angstrom(3), Z = 4.