Zb. Duan et Jg. Verkade, MOLYBDENUM(IV) AZAMOLYBDATRANES CLMO(R(3)SINCH(2)CH(2))(3)N FROM AN UNEXPECTED REACTION, Inorganic chemistry, 34(6), 1995, pp. 1576-1578
The azamolybdatranes ClMo(Me(3)SiNCH(2)CH(2))(3)N, 2a, and ClMo(t-BuMe
(2)SiNCH(2)CH(2))(3)N, 2b, were prepared by the reaction of MoCl3(THF)
(3) and the corresponding lithiated tetramines. The mu(eff) for 2a is
2.35 mu(B). This compound was structurally characterized in the solid
state by X-ray diffraction. Crystal data: cubic, a = 17.199(1) Angstro
m, V = 5087.6(11) Angstrom(3), Z = 8, space group Pa3 $$($) over bar,
R = 2.7%.