The synthesis and characterization of carboxyethylene-bridged bimetall
ic complexes CpRe(CO)(NO)CO(2)CH(2)CH(2)M (4, M = Mo(CO)(3)Cp; 7, M =
W(CO)(3)Cp; 9, M = Fe(CO)(2)Cp) and CpFe(CO)(PPh(3))CO2CH2CH2W(CO)(3)
Cp (11) are described. Thermolysis of 4, in solution or in the solid s
tate, yields the CO2-bridged compound CpRe(CO)(NO)(CO2)Mo(CO)(2)Cp (3
) as the major product. Compound Il has been structurally characterize
d. Crystal data for 11: a = 8.057(3) Angstrom, b = 33.556(13) Angstrom
, c = 11.616(3) Angstrom, beta = 100.34(2)degrees, with Z = 4 in space
group P2(1)/c.