R. Minkwitz et al., ON THE SYNTHESIS OF CH3C6H4S(O)(2)NCL2H- AND THE CRYSTAL-STRUCTURE OFCH3C6H4S(O)(2)NCL2(S BF6), Zeitschrift fur Naturforschung. B, A journal of chemical sciences, 52(1), 1997, pp. 88-94
The crystal structure of CH3C6H4S(O)(2)NCl2 is reported. Crystals are
monoclinic, space group P2(1)/c, with n = 710.0(7), b = 1615.3(13), c
= 867.2(7) pm, V = 988(2) pm(3) and Z = 4. The reaction with HF/SbF5 y
ields CH3C6H4S(O)(2)NCl2H+SbF6- the first protonated dichloroamine sal
t, its vibrational - and NMR spectra are discussed.