Rh. Vaz et al., OXIDATIVE ADDITION OF TIN THIOLATES YIELDING NEW PT-SN HETEROBIMETALLIC COMPLEXES, Journal of the Brazilian Chemical Society, 9(1), 1998, pp. 57-62
The reactions between CODPtCl2, COD = 1,5 cyclooctadiene, and the tin
thiolate compounds (Ph)(3)Sn(SPh) and (Ph)(2)Sn(SPh)(2) have been stud
ied. Reaction between CODPtCl2 and (Ph)(3)Sn(SPh) yielded two new Pt-S
n heterobimetallic complexes depending on the CODPtCl2/(Ph)(3)Sn(SPh)
molar ratio. For a 1:2 molar ratio, CODPt(SPh)(2)(Cl)Sn(Ph)(3). 2CH(2)
Cl(2), complex 1, was obtained, together with the homometallic complex
CODPt(SPh)Cl . CH2Cl2. For a 1 :1 molar ratio the complex formed was
CODPt(SPh)(Cl)(2)Sn(Ph)(3). 3CH(2)Cl(2), complex 2. Reaction with (Ph)
(2)Sn(SPh)(2) did not yielded any heterobimetallic complex, but rather
CODPt(SPh)(2). 4CH(2)Cl(2). The complexes were characterized by IR, H
-1-NMR C-13-NMR, Pt-195-NMR, Sn-119-NMR and Mossabauer spectroscopies,
elemental analysis and atomic absorption.