The first crystal structure of a metal-stabilized tetrazine anion radical:Formation of a dicopper complex through self-assembly in a comproportionation reaction
M. Schwach et al., The first crystal structure of a metal-stabilized tetrazine anion radical:Formation of a dicopper complex through self-assembly in a comproportionation reaction, INORG CHEM, 38(10), 1999, pp. 2242
The reaction of Cu, Cu(BF4)(2), PPh3, and 3,6-bis(2-pyridyl)-1,2,4,5-tetraz
ine (bptz) in the appropriate amounts gave the stable radical complex [(Ph3
P)(2)Cu(eta(4),mu-bptz)Cu(PPh3)(2)](BF4), whose crystal structure demonstra
tes pi(Ph)/pi(bptz(.-))/pi(Ph) interactions and the localization of the unp
aired electron in the central tetrazine ring.