Preparation and characterization of bis(cyclopentadienyl)zirconium(II) complexes with a tethered olefin-phosphine ligand

Unprecedented zirconium(II) complexes bearing tethered olefin-phosphine lig ands were synthesized and characterized. The molecular structures of the ne wly synthesized complexes (eta(5)-1,2-Me2C5H3)(2)Zr(CH2=CHCH2CH2PPh2) (1c) and Cp2Zr(CH2=CHCH2CH2CH2PPh2) (2a) were determined by single-crystal X-ray diffraction methods. The stability and reactivity of the series of complex es Cp2Zr{CH2=CH(CH2)(n)PR2} (n = 2, 3; R = Et, Ph) were examined. The compl ex 2a showed simultaneously both sufficient stability and high reactivity.