Copper(I) halide pi-complexes with allylacetone azine. Synthesis and crystal structure of 2CuX center dot CH2=CHCH2CH2C(CH3)=N-N=C(CH3)CH2CH2CH=CH2 (X = Cl-, Br-)

The crystals of the 2CuCl . AAAZ (I) and 2CuBr AAAZ (II) complexes were pre pared by ac electrochemical synthesis from CuCl2 . 2H(2)O or CuBr2 in ethan ol-2-butanol mixture and from allylacetone azine (AAAZ) and structurally ch aracterized (DARCh diffractometer, MoKalpha radiation, 1091 and 738 indepen dent reflections with F greater than or equal to 4 sigma(F), R = 0.027 and 0.034 for I and II, respectively). The crystals of the isostructural compou nds are orthorhombic, space group Pcab, Z = 8. Unit cell parameters for I: a = 19.199(7), b = 11.780(5), c = 13.493(4) Angstrom, V = 3052(3) Angstrom 3; for II a = 19.264(4), b = 12.340(8), c = 13.591(4) Angstrom, V = 3231(4) Angstrom(3). In both structures, the ligand is both pi- and sigma-coordina ted to the copper atom, whose trigonal-pyramidal surroundings consists of t he nitrogen and halogen atoms and C=C bond in the equatorial plane and apic al halogen atom. One of the coordinated allyl groups is locally disordered, which is particularly pronounced for II.