Palladium(II) and platinum(II) complexes based on fluorinated methoxy-beta-diketone: Structural characterization of trans-bis(1,1,1-trifluoro-5-methoxy-5-methyl-2,4-hexanedionato)palladium(II)

The Pt(II) and Pd(II) complexes based on sterically hindered fluorinated me thoxy-beta-diketone CF3-CO-CH2-CO-C(OCH3)(CH3)(2) (HMptfa) were synthesized and characterized by physicochemical methods. The elemental analytical, IR spectroscopic, and (H-1, F-19 NMR) data are presented. The behavior of the complexes during heating in an inert atmosphere and vacuum was studied. X- ray structural analysis of Pd(Mptfa)(2) was carried out: monoclinic system, a = 13.517(3), b = 9.414(2), c = 9.655(2) Angstrom, beta = 123.7(3)degrees , V = 1027.0(4) Angstrom(3), space group C2, Z = 2, p(calcd) = 1.718 g/cm(3 ). The structure of the compound is molecular and built from the isolated t rans complexes Pd(Mptfa)(2). The standard square-planar coordination of pal ladium atom incorporates four oxygen atoms of two bidentate (O,O) ligands. The Pd-O bond lengths on the sides of different substituents are equal to 1 .975 and 1.981 Angstrom, and the chelate OPdO angle is 94.08 degrees. The m olecules in the crystal form weakly bound chains along the [110] direction; the O(3)... H-gamma distance is equal to 2.53 Angstrom.