NiX2(2-RSC6H4CH=NCH2CH2N=CHC6H4SR-2) (NiX2L; L = 5) (1a, X = Br, R = C6H13;
1b, X = Cl, R = C12H25) and NiX2(2-C6H13SC6H4CH2NHCH2CH2NHCH2C6H4SC6H13-2)
(NiX2L; L = 6) (2a, X = Br; 2b, X = Cl; 2c, X = OClO3) were prepared from
ligands 5 and 6, respectively. The 1:2 metal-ligand complex Ni(OClO3)(2)(2-
RSC6H4CH2NHCH2CH2NHCH2C6H4SR-2)(2) 3, was obtained from an EtOH solution of
2c. The characterization of paramagnetic 1-3 included single-crystal X-ray
diffraction studies of 1a and 3. Complex 2c converted into 3 in the presen
ce of excess ligand 6 in CHCl3.