A novel dinuclear copper(II) complex molecule: Synthesis and crystal structure of Cu-2(phen)(2)(H2O)(2)(C5H6O4)(2) with phen=1,10-phenanthroline

Blue crystals of Cu-2(phen)(2)(H2O)(2)(C5H6O4)(2) were obtained from a CH3O H-H2O solution containing CuCl2, 1.10-phmanthroline (phen), glutaric acid a nd Na2CO3. The cn stal structure (monoclinic, P2(1)/c (no. 14), a = 10.271( 1), b = 10.595(1), c = 15.585(1) Angstrom, beta = 107.105(3)degrees, Z = 2, R = 0.0328, wR(2) = 0.1027 for 3376 observed reflections (F-o(2) greater t han or equal to 2 sigma(F-o(2)) out of 3728 unique reflections) is built up of dinuclear nuclear Cu-2(phen)(2)(H2O)(2)(C5H6O4)(2) complex molecules ce ntered at inversion centers The Cu atoms are square-pyramidally coordinated by two nitrogen atoms of one bidentate chelating phen ligand and three oxy gen atoms from two bridging glutarate anions and one axial water molecule ( d(Cu-N) = 2.018(2), 2.024(2) Angstrom; basal d(Cu-O)= 1.949(2), 1.956(2) An gstrom; axial d(Cu-O) = 2.382(2) Angstrom). Through the pi-pi stacking inte ractions extending in a direction, the complex molecules are interlinked in to 2D layers parallel to the ac plane. The resultant 2D layers are held tog ether by hydrogen bonds between water molecules and uncoordinated carboxyl oxygen atoms.