Synthesis and crystal structure of a polymeric 1,2,4,5-benzenetetracarboxylato complex of Cu(II) with imidazole, Cu-2(C10H2O8)(C3H4N2)(6)(H2O)(4) center dot 4H(2)O
Dp. Cheng et al., Synthesis and crystal structure of a polymeric 1,2,4,5-benzenetetracarboxylato complex of Cu(II) with imidazole, Cu-2(C10H2O8)(C3H4N2)(6)(H2O)(4) center dot 4H(2)O, J COORD CH, 52(3), 2001, pp. 245-251
The title complex, Cu-2(C10H2O8)(C3H4N2)(6)(H2O)(4) . 4H(2)O, consists of p
olymeric copper(II) complex anions and discrete copper(II) complex cations.
Benzenetetracarboxyl anions bridge copper(II) atoms coordinated to water a
nd imidazole groups to form the anionic polymeric chains along the a axis,
while discrete copper(II) complex cations involving four imidazole and two
water ligands are packed between parallel polymeric anionic chains, an exte
nsive H-bonding network linking complex cations and anions.