Y. Jullien et al., SPECIFIC REACTIONS OF CYANOALKYLSULFUR CO MPOUNDS - APPLICATION TO SYNTHESIS OF ACRYLIC DERIVATIVES, Phosphorus, sulfur and silicon and the related elements, 118, 1996, pp. 95-104
The reactivity of Ph-SH with acrylic compounds permits a protection of
the acrylic double bond and reaction on the protected product. In som
e cases (cyano alkyl acrylic compounds) a specific reaction can be obs
erved. So action of KCN on PhS-(CH2)(2)-COO-(CH2)(n)Cl [n = 2,3] gives
NC-(CH2)(2)-COO-(CH2)(n)SPh [the expected compound (PhS-(CH2)(2)-COO-
(CH2)(n)CN) was not isolated]. We involve a sulfonium ion as intermedi
ate for this ''abnormal'' reaction. When n = 6 the normal protection/d
eprotection reaction occurs.